Bài tập liên kết hóa học (Có lời giải chi tiết)

Cập nhật lúc: 10:40 13-05-2016 Mục tin: Hóa học lớp 10


Hệ thống tất cả các bài tập trắc nghiệm hay từ dễ đến khó, cực khó nhằm giúp bạn đọc củng cố kiến thức lý thuyết và rèn luyện kỹ năng giải bài tập.

BÀI TẬP LIÊN KẾT HÓA HỌC

(Có lời giải chi tiết)

I. Bài tập tự luận

Bài 1. Dựa vào độ âm điện, hãy nêu bản chất liên kết trong các phân tử và ion: HClO, KHS, HCO3-.

      (Cho: nguyên tố:   K         H         C         S          Cl        O

          Độ âm điện:       0,8       2,1       2,5       2,5       3,         3,5).

Bài 2. Dựa vào độ âm điện, hãy sắp xếp theo chiều tăng độ phân cực của liên kết giữa 2 nguyên tử trong phân tử các chất sau:

      CaO, MgO, CH4, AlN, N2, NaBr, BCl3, AlCl3. Phân tử chất nào có chứa liên kết ion? Liên kết cộng hoá trị không cực, có cực?

      (Cho độ âm điện của O = 3,5;  Cl = 3,0;  Br = 2,8;  Na = 0,9;  Mg = 1,2;

                                                     Ca = 1,0;  C = 2,5;  H = 2,1;  Al = 1,5;  N = 3;  B = 2,0).

Bài 3. Bằng hình vẽ mô tả sự xen phủ obitan  nguyên tử tạo ra liên kết trong phân tử H2, Cl2, N2, HCl.

Bài 4. Hãy giải thích vì sao độ âm điện của nitơ và clo đều bằng 3,0 nhưng ở điều kiện thường N2 có tính oxi hoá kém Cl2?

Bài 5. a) Nêu sự khác nhau cơ bản trong cấu tạo mạng tinh thể nguyên tử và tinh thể ion. Liên kết hoá học trong hai loại mạng đó thuộc loại liên kết gì?

      b) Giải thích tại sao naptalen và iot lại dễ thăng hoa nhưng không dẫn điện, trái lại NaCl lại rất khó thăng hoa nhưng lại dẫn điện khi nóng chảy ?

Bài 6. Khi hình thành liên kết H + H → H2 và ngược lại khi phá vỡ liên kết H­2 → H + H thì hệ thu năng lượng hay toả năng lượng ?

Xét về mặt năng lượng thì phân tử H2 có năng lượng lớn hơn hay nhỏ hơn hệ hai nguyên tử H riêng rẽ ? Trong hai hệ đó thì hệ nào bền hơn ?

Bài 7. Viết phương trình phản ứng và dùng sơ đồ biểu diễn sự trao đổi electron trong quá trình phản ứng giữa:

      a) Natri và clo                                           b) Canxi và flo

      c) Magie và oxi                                         d) Nhôm và oxi

Cho biết điện hoá trị của các nguyên tố trong các hợp chất được tạo thành

Bài 8. Viết công thức cấu tạo và cho biết cộng hoá trị của các nguyên tố trong các chất sau:

                 N2, NH3, N2O,NO2, N2O5, HNO3

Bài 9. a) Viết công thức cấu tạo của các ion sau: CO32-, NO3-, SO42-, NH4+.

b) Xác định tổng số electron trong mỗi ion trên.

Bài 10. Viết công thức cấu tạo của các chất sau:

CaCO3, Ba(NO3)2, Al2(SO4)2

Bài 11. Dự đoán dạng hình học của các phân tử sau (không cần giải thích):

 BeH2, CO2, SO2, H2O, SCl2, OF2, HCN, C2H2 , CH4, NH3

Bài 12. Cho biết trạng thái lai hoá của các nguyên tử C trong phân tử sau:

                                    CH3-CH=CH-CH(CH3)-CH=C(CH3)-C=CH

Bài 13. Hợp chất X tạo bởi hai nguyên tố A, B và có phân tử khối là 76. A và B có số oxi hóa cao nhất trong các oxit là +nO  và + mO, và số oxi hóa âm trong các hợp chất với hiđro là -nH và -mH thỏa mãn điều kiện nO = nH và mO = 3mH.

1. Tìm công thức phân tử của X, biết rằng A cố số oxi hóa cao nhất trong X.

2. Biết rằng X có cấu trúc phân tử thẳng. Hãy cho biết trạng thái lai hóa của nguyên tử A và bản chất liên kết trong X.

Bài 14. X là nguyên tố thuộc chu kì 3, X tạo với hiđro một hợp chất khí có công thức  H2X, trong đó X có số oxi hóa thấp nhất.

1. Xác định vị trí của X trong bảng tuần hoàn.

2. Trong oxit cao nhất của R thì R chiếm 40% khối lượng. Tìm khối lượng nguyên tử của R.

3. Dựa vào bảng tuần hoàn hãy cho biết X là nguyên tố nào. Viết phương trình phản ứng khi lần lượt cho H2X tác dụng với nước Cl2, dung dịch FeCl3, dung dịch CuSO4.

Bài  15. R  là một nguyên tố phi kim. Tổng đại số số oxi hóa dương cao nhất với 2 lần số oxi hóa âm thấp nhất của R là +2. Tổng số proton và nơtron của R nhỏ hơn 34.

1. Xác định R

2. X là hợp chất khí của R với hiđro, Y là oxit của R có chứa 50% oxi về khối lượng. Xác định công thức phân tử của X và Y.

3. Viết công thức cấu tạo các phân tử RO2; RO3; H2RO4.

Bài 16. Cation X+ do 5 nguyên tử của 2 nguyên tố hóa học tạo nên. Tổng số proton trong X+ là 11.

1. Xác định công thức và gọi tên cation X+.

2. Viết công thức electron của ion X+. Cho biết cấu trúc hình học của ion này?

Bài 17. Anion Y2-  do 5 nguyên tử của 2 nguyên tố hóa học tạo nên. Tổng số electron trong Y2- là 50.

1. Xác định công thức phân tử và gọi tên ion Y2-, biết rằng 2 nguyên tố trong Y2- thuộc cùng một phân nhóm và thuộc hai chu kì liên tiếp.

2. Viết công thức electron của ion Y2-. Cho biết cấu trúc hình học của ion này?

Bài 18. Có 5,56 gam hỗn hợp A gồm Fe và kim loại M (hóa trị n). Chia A làm hai phần bằng nhau:

Phần 1: Hòa tan hết trong dung dịch HCl loãng, được 1,568 lit khí H2.

Phần 2: Hòa tan hết trong dung dịch H2SO4 đặc nóng thu được 2,016 lit khí SO2.  

Viết các phương trình hóa học và xác định tên kim loại M. Các thể tích khí đo ở đktc.

Bài 19. Để khử hoàn toàn 8 gam oxit của một kim loại thành kim loại cần dùng 3,36 lit H2. Hòa tan hết lượng kim loại thu được vào dung dịch HCl loãng thấy thoát ra 2,24 lit khí H2. Biết các khí đo ở đktc.

Xác định công thức của oxit. Cho biết số oxi hóa và hóa trị của kim loại trong oxit.

Bài 20. Khử hoàn toàn 4,06 gam một oxit kim loại bằng CO ở nhiệt độ cao thành kim loại. Dẫn toàn bộ khí sinh ra vào bình đựng dung dịch Ca(OH)2 dư, thấy tạo thành 7 gam kết tủa. Nếu lấy lượng kim loại sinh ra hòa tan hết vào dung dịch HCl dư thì thu được 1,176 lit khí H2 (đktc).

1. Xác định công thức oxit kim loại.

2. Cho 4,06 gam oxit kim loại trên tác dụng hoàn toàn với 500ml dung dịch H2SO4 đặc, nóng (dư) được dung dịch X và có khí SO2 bay ra.

Hãy xác định nồng độ mol/lit của muối trong dung dịch X.

Coi thể tích của dung dịch không thay đổi trong suốt quá trình phản ứng.

Bài 21. Hòa tan hoàn toàn 7 gam kim loại M trong 200 gam dung dịch HCl vừa đủ thu được 206,75 gam dung dịch A.

1. Xác định M và nồng độ % của dung dịch HCl.

2. Hòa tan 6,28 gam hỗn hợp X gồm M và một oxit của M trong 170 ml dung dịch HNO3 2M (loãng, vừa đủ) thu được 1,232 lit NO (đktc).

Tìm công thức của oxit. Cho biết số oxi hóa và hóa trị của M trong oxit.

II. Câu hỏi, bài tập trắc nghiệm khách quan

1.       Lai hoá sp3 là sự tổ hợp :

A. 1 AOs với 3 AOp.                            B. 2 AOs với 2 AOp.

C. 1 AOs với 4 AOp.                            D. 3 AOs với 1 AOp.

2.       Trong phân tử CH4 nguyên tử C lai hoá kiểu :

A. sp                  B. sp2                           C. sp3                                   D. sp3d

3.       Hợp chất X gồm 2 nguyên tố là A có Z = 16 và  B có Z = 8. Trong X, A chiếm 40% về khối lượng.

Các loại liên kết trong X là :

A. cộng hóa trị.

B. cộng hóa trị có cực.

C. cộng hóa trị không cực.

D. cộng hóa trị và liên kết cho - nhận.

4.       Dãy gồm các phân tử có cùng một kiểu liên kết :

A. Cl2, Br2, I2, HCl                                B. Na2O, KCl, BaCl2, Al2O3

C. HCl, H2S, NaCl, N2O                       D. MgO, H2SO4, H3PO4, HCl

5.       Dãy chất được sắp xếp theo chiều tăng dần sự phân cực liên kết trong phân tử :

A. HCl, Cl2, NaCl                                 B. NaCl, Cl2, HCl

C. Cl2, HCl, NaCl                                  D. Cl2, NaCl, HCl

6.       Mạng tinh thể iot thuộc loại

A.  mạng tinh thể kim loại.                    B.  mạng tinh thể nguyên tử.

C.  mạng tinh thể ion.                            D.  mạng tinh thể phân tử.

7.       Điện hóa trị của natri trong NaCl là

A : +1                B : 1+                          C : 1                D. 1-

8.       Số oxi hóa của nguyên tử C trong CO2,  H2CO3,  HCOOH,  CH4 lần lượt là

A.  -4; + 4; +3; +4                                 B.  +4; +4; +2; +4

C.  +4; +4; +2; -4                                  D.  +4; -4; +3; +4

9.       Các liên kết trong phân tử nitơ gồm

A. 3 liên kết p.                                       B.  1 liên kết p, 2 liên kết s.

C.  1 liên kết s, 2 liên kết p.                  D.  3 liên kết s.

10.     Cộng hóa trị của nitơ trong hợp chất nào sau đây là lớn nhất ?

A.  N2                B. NH3                        C.  NO                        D.  HNO3      

11.      Liên kết hoá học trong phân tử HCl là :

A.  liên kết ion.

B.  liên kết cộng hoá trị phân cực

C.  liên kết cho - nhận.

D.  liên kết cộng hoá trị không phân cực.

12.     Công thức electron của Cl2 là :

A.        B.                  C.                   D.  

13.     Mạng tinh thể kim cương thuộc loại

A.  mạng tinh thể kim loại.                    B.  mạng tinh thể nguyên tử.

C.  mạng tinh thể ion.                            D.  mạng tinh thể phân tử.

14.     Cho biết độ âm điện của O là 3,44 và của Si là 1,90. Liên kết trong phân tử SiO2 là liên kết

A.  ion.                                                   B.  cộng hoá trị phân cực.

C.  cộng hoá trị không phân cực.          D.  phối trí.

15.     Số oxi hoá của Mn trong K2MnO4 là :

A. +7                 B.+6                            C. -6                           D. +5

16.     Cộng hoá trị của cacbon và oxi trong phân tử CO2 là :

A.   4 và 2          B.   4 và -2                 C.   +4 và -2               D.   3 và 2

III. Hướng dẫn giải – Đáp án

Bài 1. Trong HClO: H-O-Cl có liên kết H-O là cộng hoá trị phân cực (Dc = 1,4)

                                                            liên kết O-Cl là cộng hoá trị phân cực yếu (Dc = 0,5)

      Trong KHS:  K-S-H có liên kết K-S là liên kết ion (Dc = 1,7)

                                                            liên kết S-H là cộng hoá trị phân cực yếu (Dc = 0,4)

Bài 2. Thứ tự tăng dần độ phân cực của liên kết:              

 

N2,

CH4,

BCl3,

AlN,

AlCl3 ,

NaBr,

MgO,

CaO

Dc =

0,0

0,4

1,0

1,5

1,5

1,9

2,3

2,5

      - Phân tử chất có liên kết ion: NaBr, MgO, CaO

      - Phân tử chất có liên kết cộng hoá trị có cực: CH4, BCl3, AlN, AlCl3

      - Phân tử chất có liên kết cộng hoá trị không cực: N2,

Bài 4. Ở điều kiện thường, phân tử N2 có liên kết ba bền vững (NºN) hơn so với phân tử Cl2 chỉ có liên kết đơn (Cl-Cl) Þ phân tử kém bền hơn sẽ có tính oxi hoá mạnh hơn

Bài 5.

      b) Phân tử naptalen và iot có cấu trúc bền vững bởi các liên kết cộng hoá trị kém phân cực, đồng thời liên kết liên phân tử cũng kém bền vững (không ở dạng mạng tinh thể) nên khi đun nóng dễ dàng tách ra khỏi nhau nhanh đến làm tăng nhanh khoảng cách giữa các phân tử (thăng hoa). Ngược lại, phân tử NaCl có cấu trúc bền vững theo kiểu mạng tinh thể tạo bởi các liên kết ion (khó thăng hoa), khi nóng chảy có thể phân li thành các ion dương và ion âm Þ dẫn điện.

Bài 6. Khi hình thành liên kết H + H → H2 hệ toả ra năng lượng và ngược lại khi phá vỡ liên kết H­2 → H + H thì thu thêm năng lượng ?

Xét về mặt năng lượng thì phân tử H2 có năng lượng lớn hơn hệ hai nguyên tử H riêng rẽ ? Trong hai hệ đó thì hệ H2 bền hơn hệ 2H?

Bài 7. a) Na → Na+ + e     và  Cl + e → Cl- Þ  2Na + Cl2 → 2Na+ + 2Cl- → 2NaCl

      b) Ca → Ca2+ + 2e   và  F + e → F-   Þ  Ca + F2    → Ca2+ + 2F-    → CaF2

      b) Mg → Mg2+ + 2e  và  O + 2e → O2- Þ  2Mg + O2 → 2Mg2+ + 2O2- → 2MgO

      b) Al → Al3+ + 3e  và  O + 2e → O2- Þ  4Al + 3O2 → 4Al3+ + 6O2- → 2Al2O3

Bài 8. Viết công thức cấu tạo và cho biết cộng hoá trị của các nguyên tố trong các chất sau:

                              N2, NH3, N2O,NO2, N2O5, HNO3

Bài 9. a) Viết công thức cấu tạo của các ion sau: CO32-, NO3-, SO42-, NH4+.

b) Xác định tổng số electron trong mỗi ion trên.

Bài 10.            

Bài 11. Dự đoán dạng hình học của các phân tử sau (không cần giải thích):

- Dạng đường thẳng: BeH2, CO2, HCN, C2H2

- Dạng chữ V (tam giác phẳng): SO2, H2O, SCl2, OF2,

- Dạng tứ diện: CH4, NH3

Bài 12. Trạng thái lai hoá của các nguyên tử C trong phân tử ghi lần lượt từ trái qua phải:

                                    CH3-CH=CH-CH(CH3)-CH=C(CH3)-CºCH

                                       sp3 - sp2 - sp2 -  sp3 - sp2 - sp2 - sp – sp

Bài 13.

a. A, B có số oxi hóa cao nhất trong các oxit là +nO  và + mO nên lớp ngoài cùng của A, B có số electron là nO  và mO.

A, B có số oxi hóa âm trong các hợp chất với hiđro là -nH  và - mH nên ta thấy để hoàn thành lớp vỏ bão hòa 8 electron, lớp ngoài cùng của A, B cần nhận thêm số electron là nH  và mH.

Như vậy: nO + nH = 8 và mO + mH = 8.

Theo bài: nO = nH và mO = 3mH.

Từ đây tìm được nO = nH = 4, mO = 6, nH = 2.

A có số oxi hóa dương cao nhất là +4 nên A thuộc nhóm IV, B có số oxi hóa dương cao nhất là +6 nên B thuộc nhóm VI.

Trong hợp chất X, A có số oxi hóa +4 (nhường 4 electron) nên một nguyên tử A liên kết với 2 nguyên tử B, trong đó B có số oxi hóa -2.

Công thức phân tử của X là AB2.

Theo bài: khối lượng phân tử của X là 76u nên MA + 2MB = 76u.

 MB <  = 38u.

Mặt khác, B thuộc nhóm VI và tạo được số oxi hóa cao nhất trong oxit là +6 nên B là lưu huỳnh. Vậy MB = 32u, suy ra MA = 76u - 232u = 12u. A là cacbon.

Công thức của X là CS2.

2. Theo bài, CS2 có cấu trúc thẳng nên nguyên tử C ở trạng thái lai hóa sp.

        Cấu hình electron lớp ngoài cùng của nguyên tử lưu huỳnh:

Liên kết trong phân tử CS2 được hình thành như sau:

Hai obitan lai hóa sp của C xen phủ trục với hai obitan 3p chứa electron độc      thân của 2 lưu huỳnh tạo thành 2 liên kết .

Hai obitan 2px, 2py không tham gia lai hóa của C xen phủ bên với hai obitan 3p chứa electron độc thân của 2 lưu huỳnh tạo thành 2 liên kết .

Như vậy, nguyên tử cacbon tạo với mỗi nguyên tử lưu huỳnh 1 liên kết  và 1 liên kết . Công thức cấu tạo của phân tử CS2 như sau:

Bài 14.

1. Theo bài ra, hóa trị của X trong hợp chất với hidro là II nên hóa trị cao nhất trong oxit là VI.

Vậy X thuộc chu kỳ 3, nhóm VIA trong bảng tuần hoàn.

2. R thuộc nhóm VI nên hóa trị cao nhất trong oxit là VI, vậy công thức oxit cao nhất có dạng RO3. Trong oxit này R chiếm  40% khối lượng nên:

  MR = 32.

3. X là S. Các phương trình phản ứng:

H2S  +  4Cl2  +  4H2O    H2SO4  +  8HCl

H2S  +  2FeCl3     2FeCl2  +  S   +  2HCl

H2S  +  CuSO4     CuS   +  H2SO4

Bài 15

1. Gọi số oxi hóa dương cao nhất và số oxi hóa âm thấp nhất của R lần lượt là +m và -n.

Số oxi hóa cao nhất của R trong oxit là +m nên ở lớp ngoài cùng nguyên tử R có m electron.

Số oxi hóa trong hợp chất của R với hiđro là -n nên để đạt được cấu hình 8 electron bão hòa của khí hiếm, lớp ngoài cùng nguyên tử R cần nhận thêm n electron.

Ta có: m + n = 8.  Mặt khác, theo bài ra: +m + 2(-n) = +2   m - 2n = 2.

Từ đây tìm được: m = 6 và n = 2. Vậy R là phi kim thuộc nhóm VI.

Số khối của R < 34 nên R là O hay S. Do oxi không tạo được số oxi hóa cao nhất là +6 nên R là lưu huỳnh.

2. Trong hợp chất X, S có số oxi hóa thấp nhất nên X có công thức là H2S.

Gọi công thức oxit Y là SOn.

Do %S = 50% nên  =  n =  2.  Công thức của Y là SO2.

3. Công thức cấu tạo của SO2; SO3; H2SO4:

Bài 16

1. Số proton trung bình của một hạt nhân nguyên tử trong X+ là = 2,2. Vậy một nguyên tố trong X+ có điện tích hạt nhân nhỏ hơn 2,2, nguyên tố đó là H (Z = 1). Ta loại trường hợp He (Z = 2) vì He là khí hiếm không tạo được hợp chất.

Vậy công thức ion X+ có dạng: [A5-n­Hn]+. Trong đó : (5-n).ZA + n = 11.

Ta lập bảng sau:

n

1

2

3

4

ZA (A)

2,5 (loại)

3 (Li)

4 (Be)

7 (N)

Ta loại các trường hợp A là Li, Be vì các ion X+ tương ứng không tồn tại. 

Trường hợp A là nitơ thỏa mãn vì ion amoni tồn tại. Vậy X+ là ion NH.

2. Công thức electron của ion NHnhư sau:

Công thức electron                                                   Công thức cấu tạo

Bài 17. Gọi công thức của Y2- là .

Theo bài, tổng số electron trong Y2- bằng 50 nên tổng số proton trong Y2- bằng 48.

Ta có: (5-m)ZE + mZF = 48.                                                                             (1)

Ta nhận thấy:

Số proton trung bình của một hạt nhân nguyên tử trong Y2- là = 9,6 nên E thuộc chu kỳ 2, F ở chu kỳ kế tiếp với E nên F thuộc chu kỳ 3. Mặt khác, hai nguyên tố E và F thuộc cùng một phân nhóm nên ZF - ZE = 8.   (2)

Từ (1), (2) ta có: 5ZE  +  8m = 48.

Ta lập bảng sau:

m

1

2

3

4

ZE (E)

8 (O)

6,4 (loại)

4,8 (loại)

3,2 (loại)

Vậy E là O. Từ đó suy ra F là S. Ion Y2- cần tìm là ion sunfat SO.

2. Công thức electron của ion SO như sau:

Công thức electron                                                   Công thức cấu tạo

Bài 18.

Gọi số mol trong mỗi phần: Fe = x mol; M = y mol.

Phần 1:

Fe  +  2HCl    FeCl2  +  H2

(mol):   x                                         x

2M  +  2nHCl    2MCln  +  nH2

(mol):    y                                          0,5ny

Số mol H2 = 0,07 nên x + 0,5ny = 0,07.

Phần 2:

2Fe  +  6H2SO4(đặc)    Fe2(SO4)3  +  3SO2 +  6H2O

(mol):   x                                                                   1,5x

2M  +  2nH2SO4(đặc)    M2(SO4)n  +  nSO2 +  2nH2O

(mol):   y                                                                   0,5nx

Số mol SO2 = 0,09 nên  1,5x + 0,5ny = 0,09. Vậy x = 0,04 và ny = 0,06.

Mặt khác: 56x + My = 2,78 nên My = 0,54. Vậy hay M = 9n.

Ta lập bảng sau:

n

1

2

3

 

M

9 (loại)

18 (loại)

27 (nhận)

 

Vậy M là Al.

Bài 19

Gọi công thức oxit là MxOy = a mol.             

MxOy  +  yH2   xM  +  yH2O

(mol):    a             ay         ax

Ta có: a(Mx + 16y) = 8 và ay = 0,15. Như vậy Max = 5,6.

2M  +  2nHCl    2MCln  +   nH2

(mol):  ax                                            0,5nax

Ta có: 0,5nax = 0,1 hay nax = 0,2.

 Lập tỉ lệ: . Vậy M = 28n.

Ta lập bảng sau:

n

1

2

3

M

28 (loại)

56 (nhận)

84 (loại)

Vậy kim loại M là Fe.

Lập tỉ lệ: . Vậy công thức oxit là Fe2O3.

Số oxi hóa của sắt trong oxit là +3, hóa trị của sắt là III.

Bài 20

Gọi công thức oxit là: MxOy = a mol. Ta có: a(Mx + 16y) = 4,06.

MxOy  +  yCO    xM  +  yCO2

(mol):    a                                   ax        ay

CO2  +  Ca(OH)2    CaCO3¯  +  H2O

(mol):   ay                                 ay

Ta có: ay = 0,07. Từ đây suy ra: Max = 2,94.

2M  +  2nHCl    2MCln  +  nH2

(mol):  ax                                            0,5nax

Ta có: 0,5nax = 0,0525 hay nax = 0,105.

 Lập tỉ lệ: . Vậy M = 28n.

Ta lập bảng sau:

n

1

2

3

M

28 (loại)

56 (nhận)

84 (loại)

Vậy kim loại M là Fe.

Lập tỉ lệ: . Vậy công thức oxit là Fe3O4.

Bài 21

1. Gọi hóa trị kim loại là n và số mol là a mol. Ta có:  Ma = 7.

2M  +  2nHCl    2MCln  +  nH2

(mol):    a                               a            0,5na

Khối lượng dung dịch sau phản ứng tăng 6,75 gam nên:

7 - 0,5na2 = 6,75 hay na = 0,25.

Lập tỉ lệ: . Vậy M = 28n.

Ta lập bảng sau:

n

1

2

3

M

28 (loại)

56 (nhận)

84 (loại)

Vậy kim loại M là Fe.

2. Gọi số mol: Fe = b và FeO­y = c mol. Ta có 56b + (56x + 16y)c = 6,28.

Fe  +  4HNO3    Fe(NO3)3  +  NO  + 2H2O

(mol):    b        4b                                      b

3FexOy + (12x - 2y)HNO3  3xFe(NO3)3 + (3x - 2y)NO+ (6x - y)H2O

(mol):     c                                                            

Ta có:  4b +  = 0,34 và b +  = 0,055.

Từ đây tính được:  b = 0,05 mol; xc = 0,045 mol và yc = 0,06 mol.

Lập tỉ lệ: . Vậy công thức oxit là Fe3O4.

Số oxi hóa của sắt trong oxit là +, hóa trị của sắt là II và III (FeO.Fe2O3).

Đáp án câu hỏi, bài tập trắc nghiệm khách quan

Câu

1

2

3

4

5

6

7

8

9

10

11

12

13

14

15

16

ĐA

C

<span style="font-family: 'times new roman', times; font-size: medium;

Sub đăng ký kênh giúp Ad nhé !

Tất cả nội dung bài viết. Các em hãy xem thêm và tải file chi tiết dưới đây:

Luyện Bài tập trắc nghiệm môn Hóa lớp 10 - Xem ngay

>> Học trực tuyến Lớp 11 năm học mới trên Tuyensinh247.com, mọi lúc, mọi nơi tất cả các môn. Các thầy cô giỏi nổi tiếng, dạy hay dễ hiểu

Cập nhật thông tin mới nhất của kỳ thi tốt nghiệp THPT Quốc Gia 2021